C11H12ClNO3S — CID 80640905
methyl 1-(3-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 80640905) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is methyl 1-(3-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(3-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80640905 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | methyl 1-(3-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)c1sccc1Cl |
| InChI | InChI=1S/C11H12ClNO3S/c1-16-11(15)8-3-2-5-13(8)10(14)9-7(12)4-6-17-9/h4,6,8H,2-3,5H2,1H3 |
| InChIKey | QDCYMEHBVJVPTK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |