C11H12ClN3O3 — CID 60859196
methyl 1-(6-chloropyridazine-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 60859196) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is methyl 1-(6-chloropyridazine-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(6-chloropyridazine-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 60859196 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | methyl 1-(6-chloropyridazine-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C11H12ClN3O3/c1-18-11(17)8-3-2-6-15(8)10(16)7-4-5-9(12)14-13-7/h4-5,8H,2-3,6H2,1H3 |
| InChIKey | DYPVCWQREGHIQL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |