C12H15N3O3 — CID 79833939
methyl (2R)-1-(pyrazine-2-carbonyl)piperidine-2-carboxylate (PubChem CID 79833939) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl (2R)-1-(pyrazine-2-carbonyl)piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(pyrazine-2-carbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 79833939 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | methyl (2R)-1-(pyrazine-2-carbonyl)piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1C(=O)c1cnccn1 |
| InChI | InChI=1S/C12H15N3O3/c1-18-12(17)10-4-2-3-7-15(10)11(16)9-8-13-5-6-14-9/h5-6,8,10H,2-4,7H2,1H3/t10-/m1/s1 |
| InChIKey | MOVOFXNSPWUJQD-SNVBAGLBSA-N |
| XLogP | 0.64 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |