C9H11Cl2N5O — CID 62868559
1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidine-2-carboxamide (PubChem CID 62868559) has the molecular formula C9H11Cl2N5O and a molecular weight of 276.13 g/mol. Its IUPAC name is 1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidine-2-carboxamide.
| Compound Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 62868559 |
| Molecular Formula | C9H11Cl2N5O |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H11Cl2N5O/c10-7-13-8(11)15-9(14-7)16-4-2-1-3-5(16)6(12)17/h5H,1-4H2,(H2,12,17) |
| InChIKey | ASIMVNBMHCNQGX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |