C15H24ClN5 — CID 11893825
2-chloro-4,6-bis[(2S)-2-methylpiperidin-1-yl]-1,3,5-triazine (PubChem CID 11893825) has the molecular formula C15H24ClN5 and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-chloro-4,6-bis[(2S)-2-methylpiperidin-1-yl]-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis[(2S)-2-methylpiperidin-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 11893825 |
| Molecular Formula | C15H24ClN5 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-chloro-4,6-bis[(2S)-2-methylpiperidin-1-yl]-1,3,5-triazine |
| SMILES | C[C@H]1CCCCN1c1nc(Cl)nc(N2CCCC[C@@H]2C)n1 |
| InChI | InChI=1S/C15H24ClN5/c1-11-7-3-5-9-20(11)14-17-13(16)18-15(19-14)21-10-6-4-8-12(21)2/h11-12H,3-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | VMLHWBORKYUJSA-RYUDHWBXSA-N |
| XLogP | 3.28 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |