C11H13ClN2O — CID 70876168
(2S)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide (PubChem CID 70876168) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70876168 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN2O/c12-8-3-5-9(6-4-8)14-7-1-2-10(14)11(13)15/h3-6,10H,1-2,7H2,(H2,13,15)/t10-/m0/s1 |
| InChIKey | JKPYMLLXKQOLNQ-JTQLQIEISA-N |
| XLogP | 1.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |