C11H13FN2O2 — CID 86258443
1-(4-fluoro-3-hydroxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 86258443) has the molecular formula C11H13FN2O2 and a molecular weight of 224.24 g/mol. Its IUPAC name is 1-(4-fluoro-3-hydroxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluoro-3-hydroxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86258443 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(4-fluoro-3-hydroxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1c1ccc(F)c(O)c1 |
| InChI | InChI=1S/C11H13FN2O2/c12-8-4-3-7(6-10(8)15)14-5-1-2-9(14)11(13)16/h3-4,6,9,15H,1-2,5H2,(H2,13,16) |
| InChIKey | QVHHLEGOQDCGGO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |