C9H13ClN2OS — CID 131207459
1-(4-chloro-1,3-thiazol-2-yl)-2-methylpiperidin-3-ol (PubChem CID 131207459) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 1-(4-chloro-1,3-thiazol-2-yl)-2-methylpiperidin-3-ol.
| Compound Name | 1-(4-chloro-1,3-thiazol-2-yl)-2-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 131207459 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 1-(4-chloro-1,3-thiazol-2-yl)-2-methylpiperidin-3-ol |
| SMILES | CC1C(O)CCCN1c1nc(Cl)cs1 |
| InChI | InChI=1S/C9H13ClN2OS/c1-6-7(13)3-2-4-12(6)9-11-8(10)5-14-9/h5-7,13H,2-4H2,1H3 |
| InChIKey | VBGNHGOEAGNCPH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |