C7H9ClN2OS — CID 104892830
(3S)-1-(4-chloro-1,3-thiazol-2-yl)pyrrolidin-3-ol (PubChem CID 104892830) has the molecular formula C7H9ClN2OS and a molecular weight of 204.68 g/mol. Its IUPAC name is (3S)-1-(4-chloro-1,3-thiazol-2-yl)pyrrolidin-3-ol.
| Compound Name | (3S)-1-(4-chloro-1,3-thiazol-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 104892830 |
| Molecular Formula | C7H9ClN2OS |
| Molecular Weight | 204.68 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | (3S)-1-(4-chloro-1,3-thiazol-2-yl)pyrrolidin-3-ol |
| SMILES | O[C@H]1CCN(c2nc(Cl)cs2)C1 |
| InChI | InChI=1S/C7H9ClN2OS/c8-6-4-12-7(9-6)10-2-1-5(11)3-10/h4-5,11H,1-3H2/t5-/m0/s1 |
| InChIKey | MPGXWVSDGRQYSD-YFKPBYRVSA-N |
| XLogP | 1.37 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |