C10H15ClN4OS — CID 83157135
1-(4-chloro-1,3-thiazol-2-yl)-N-ethylpiperazine-2-carboxamide (PubChem CID 83157135) has the molecular formula C10H15ClN4OS and a molecular weight of 274.78 g/mol. Its IUPAC name is 1-(4-chloro-1,3-thiazol-2-yl)-N-ethylpiperazine-2-carboxamide.
| Compound Name | 1-(4-chloro-1,3-thiazol-2-yl)-N-ethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 83157135 |
| Molecular Formula | C10H15ClN4OS |
| Molecular Weight | 274.78 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-(4-chloro-1,3-thiazol-2-yl)-N-ethylpiperazine-2-carboxamide |
| SMILES | CCNC(=O)C1CNCCN1c1nc(Cl)cs1 |
| InChI | InChI=1S/C10H15ClN4OS/c1-2-13-9(16)7-5-12-3-4-15(7)10-14-8(11)6-17-10/h6-7,12H,2-5H2,1H3,(H,13,16) |
| InChIKey | DNNPQYXTOQPYLU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.78 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |