C13H21N5O3 — CID 115355359
1-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperazine-2-carboxamide (PubChem CID 115355359) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperazine-2-carboxamide.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 115355359 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperazine-2-carboxamide |
| SMILES | CCNC(=O)C1CNCCN1c1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C13H21N5O3/c1-4-15-12(19)9-8-14-5-6-18(9)13-16-10(20-2)7-11(17-13)21-3/h7,9,14H,4-6,8H2,1-3H3,(H,15,19) |
| InChIKey | YBHXDRVSIUJYCY-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |