C14H20N4O3 — CID 105064126
N-ethyl-1-(3-methoxypyridine-4-carbonyl)piperazine-2-carboxamide (PubChem CID 105064126) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-ethyl-1-(3-methoxypyridine-4-carbonyl)piperazine-2-carboxamide.
| Compound Name | N-ethyl-1-(3-methoxypyridine-4-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 105064126 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-ethyl-1-(3-methoxypyridine-4-carbonyl)piperazine-2-carboxamide |
| SMILES | CCNC(=O)C1CNCCN1C(=O)c1ccncc1OC |
| InChI | InChI=1S/C14H20N4O3/c1-3-17-13(19)11-8-16-6-7-18(11)14(20)10-4-5-15-9-12(10)21-2/h4-5,9,11,16H,3,6-8H2,1-2H3,(H,17,19) |
| InChIKey | RAKXBFNDHJTXTN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |