C12H16IN3O2S — CID 79694089
N-ethyl-1-(5-iodothiophene-3-carbonyl)piperazine-2-carboxamide (PubChem CID 79694089) has the molecular formula C12H16IN3O2S and a molecular weight of 393.25 g/mol. Its IUPAC name is N-ethyl-1-(5-iodothiophene-3-carbonyl)piperazine-2-carboxamide.
| Compound Name | N-ethyl-1-(5-iodothiophene-3-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 79694089 |
| Molecular Formula | C12H16IN3O2S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | N-ethyl-1-(5-iodothiophene-3-carbonyl)piperazine-2-carboxamide |
| SMILES | CCNC(=O)C1CNCCN1C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C12H16IN3O2S/c1-2-15-11(17)9-6-14-3-4-16(9)12(18)8-5-10(13)19-7-8/h5,7,9,14H,2-4,6H2,1H3,(H,15,17) |
| InChIKey | HFTXPXQJHLPLHO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|