About 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide
1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide (PubChem CID 107973359) has the molecular formula C13H15Br2N3O2
and a molecular weight of 405.09 g/mol. Its IUPAC name is 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide.
Molecular Properties
| Compound Name | 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide |
| PubChem CID | 107973359 |
| Molecular Formula | C13H15Br2N3O2 |
| Molecular Weight | 405.09 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)C1CNCCN1C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H15Br2N3O2/c1-16-12(19)11-7-17-2-3-18(11)13(20)8-4-9(14)6-10(15)5-8/h4-6,11,17H,2-3,7H2,1H3,(H,16,19) |
| InChIKey | QKNBBFVPYHESSL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.09 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide?
The IUPAC name of 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide (CID 107973359) is 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide.
What is the SMILES notation for 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide?
The canonical SMILES for 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide is CNC(=O)C1CNCCN1C(=O)c1cc(Br)cc(Br)c1.
What is the InChIKey of 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide?
The InChIKey is QKNBBFVPYHESSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Br2N3O2/c1-16-12(19)11-7-17-2-3-18(11)13(20)8-4-9(14)6-10(15)5-8/h4-6,11,17H,2-3,7H2,1H3,(H,16,19).
What are the key properties of 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide?
1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide has a molecular weight of 405.09 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dibromobenzoyl)-N-methylpiperazine-2-carboxamide is sourced from PubChem (CID 107973359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).