C13H14ClF2N3O2 — CID 82772342
1-(4-chloro-2,5-difluorobenzoyl)-N-methylpiperazine-2-carboxamide (PubChem CID 82772342) has the molecular formula C13H14ClF2N3O2 and a molecular weight of 317.72 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorobenzoyl)-N-methylpiperazine-2-carboxamide.
| Compound Name | 1-(4-chloro-2,5-difluorobenzoyl)-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 82772342 |
| Molecular Formula | C13H14ClF2N3O2 |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 1-(4-chloro-2,5-difluorobenzoyl)-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)C1CNCCN1C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H14ClF2N3O2/c1-17-12(20)11-6-18-2-3-19(11)13(21)7-4-10(16)8(14)5-9(7)15/h4-5,11,18H,2-3,6H2,1H3,(H,17,20) |
| InChIKey | OPIUGRCROSSGEL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|