C11H22N4O2 — CID 79163472
1-N,2-N-diethyl-1-N-methylpiperazine-1,2-dicarboxamide (PubChem CID 79163472) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-N,2-N-diethyl-1-N-methylpiperazine-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-diethyl-1-N-methylpiperazine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 79163472 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-N,2-N-diethyl-1-N-methylpiperazine-1,2-dicarboxamide |
| SMILES | CCNC(=O)C1CNCCN1C(=O)N(C)CC |
| InChI | InChI=1S/C11H22N4O2/c1-4-13-10(16)9-8-12-6-7-15(9)11(17)14(3)5-2/h9,12H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | KUKOGZOGEAYGLL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |