C13H18Cl2N4O — CID 116519823
1-[(4,6-dichloro-3-pyridinyl)methyl]-N-ethylpiperazine-2-carboxamide (PubChem CID 116519823) has the molecular formula C13H18Cl2N4O and a molecular weight of 317.22 g/mol. Its IUPAC name is 1-[(4,6-dichloro-3-pyridinyl)methyl]-N-ethylpiperazine-2-carboxamide.
| Compound Name | 1-[(4,6-dichloro-3-pyridinyl)methyl]-N-ethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 116519823 |
| Molecular Formula | C13H18Cl2N4O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-[(4,6-dichloro-3-pyridinyl)methyl]-N-ethylpiperazine-2-carboxamide |
| SMILES | CCNC(=O)C1CNCCN1Cc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N4O/c1-2-17-13(20)11-7-16-3-4-19(11)8-9-6-18-12(15)5-10(9)14/h5-6,11,16H,2-4,7-8H2,1H3,(H,17,20) |
| InChIKey | UQNCUKOFDOZFQB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|