C13H17Cl2N3O2 — CID 116519819
ethyl 1-[(4,6-dichloro-3-pyridinyl)methyl]piperazine-2-carboxylate (PubChem CID 116519819) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is ethyl 1-[(4,6-dichloro-3-pyridinyl)methyl]piperazine-2-carboxylate.
| Compound Name | ethyl 1-[(4,6-dichloro-3-pyridinyl)methyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 116519819 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | ethyl 1-[(4,6-dichloro-3-pyridinyl)methyl]piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CNCCN1Cc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-2-20-13(19)11-7-16-3-4-18(11)8-9-6-17-12(15)5-10(9)14/h5-6,11,16H,2-4,7-8H2,1H3 |
| InChIKey | VMHDXKPXGMUROF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|