C10H17ClN2O2 — CID 77074295
ethyl 1-(3-chloroprop-2-enyl)piperazine-2-carboxylate (PubChem CID 77074295) has the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. Its IUPAC name is ethyl 1-(3-chloroprop-2-enyl)piperazine-2-carboxylate.
| Compound Name | ethyl 1-(3-chloroprop-2-enyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 77074295 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | ethyl 1-(3-chloroprop-2-enyl)piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CNCCN1CC=CCl |
| InChI | InChI=1S/C10H17ClN2O2/c1-2-15-10(14)9-8-12-5-7-13(9)6-3-4-11/h3-4,9,12H,2,5-8H2,1H3 |
| InChIKey | BWIJPFZCAHCKNH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |