C14H19FN2O3 — CID 107692096
ethyl 1-[(3-fluoro-4-hydroxyphenyl)methyl]piperazine-2-carboxylate (PubChem CID 107692096) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is ethyl 1-[(3-fluoro-4-hydroxyphenyl)methyl]piperazine-2-carboxylate.
| Compound Name | ethyl 1-[(3-fluoro-4-hydroxyphenyl)methyl]piperazine-2-carboxylate |
|---|---|
| PubChem CID | 107692096 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | ethyl 1-[(3-fluoro-4-hydroxyphenyl)methyl]piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CNCCN1Cc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O3/c1-2-20-14(19)12-8-16-5-6-17(12)9-10-3-4-13(18)11(15)7-10/h3-4,7,12,16,18H,2,5-6,8-9H2,1H3 |
| InChIKey | OKCKRHGUDJHBKH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |