C16H20N2O3 — CID 80702284
ethyl 1-(1-benzofuran-3-ylmethyl)piperazine-2-carboxylate (PubChem CID 80702284) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl 1-(1-benzofuran-3-ylmethyl)piperazine-2-carboxylate.
| Compound Name | ethyl 1-(1-benzofuran-3-ylmethyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 80702284 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethyl 1-(1-benzofuran-3-ylmethyl)piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CNCCN1Cc1coc2ccccc12 |
| InChI | InChI=1S/C16H20N2O3/c1-2-20-16(19)14-9-17-7-8-18(14)10-12-11-21-15-6-4-3-5-13(12)15/h3-6,11,14,17H,2,7-10H2,1H3 |
| InChIKey | GJYMNORYCHTXSK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |