C10H13BrN2O2S — CID 79399934
ethyl 1-(4-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxylate (PubChem CID 79399934) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is ethyl 1-(4-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(4-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 79399934 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | ethyl 1-(4-bromo-1,3-thiazol-2-yl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1c1nc(Br)cs1 |
| InChI | InChI=1S/C10H13BrN2O2S/c1-2-15-9(14)7-4-3-5-13(7)10-12-8(11)6-16-10/h6-7H,2-5H2,1H3 |
| InChIKey | HHQUHSRJJASGMJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |