C9H11ClN4O2 — CID 137009721
4-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-2-one (PubChem CID 137009721) has the molecular formula C9H11ClN4O2 and a molecular weight of 242.67 g/mol. Its IUPAC name is 4-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-2-one.
| Compound Name | 4-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 137009721 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-(5-chloro-6-oxo-1H-pyrimidin-4-yl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(c2nc[nH]c(=O)c2Cl)CCCN1 |
| InChI | InChI=1S/C9H11ClN4O2/c10-7-8(12-5-13-9(7)16)14-3-1-2-11-6(15)4-14/h5H,1-4H2,(H,11,15)(H,12,13,16) |
| InChIKey | CUJHIBHPHOQDFW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |