C8H9Cl2N5O — CID 81036173
4-(3,6-dichloro-1,2,4-triazin-5-yl)-1,4-diazepan-2-one (PubChem CID 81036173) has the molecular formula C8H9Cl2N5O and a molecular weight of 262.10 g/mol. Its IUPAC name is 4-(3,6-dichloro-1,2,4-triazin-5-yl)-1,4-diazepan-2-one.
| Compound Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 81036173 |
| Molecular Formula | C8H9Cl2N5O |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(c2nc(Cl)nnc2Cl)CCCN1 |
| InChI | InChI=1S/C8H9Cl2N5O/c9-6-7(12-8(10)14-13-6)15-3-1-2-11-5(16)4-15/h1-4H2,(H,11,16) |
| InChIKey | PIYSAOMEQPQQEO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |