C10H15N5O — CID 80843367
4-(2-amino-5-methylpyrimidin-4-yl)-1,4-diazepan-2-one (PubChem CID 80843367) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-(2-amino-5-methylpyrimidin-4-yl)-1,4-diazepan-2-one.
| Compound Name | 4-(2-amino-5-methylpyrimidin-4-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 80843367 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 4-(2-amino-5-methylpyrimidin-4-yl)-1,4-diazepan-2-one |
| SMILES | Cc1cnc(N)nc1N1CCCNC(=O)C1 |
| InChI | InChI=1S/C10H15N5O/c1-7-5-13-10(11)14-9(7)15-4-2-3-12-8(16)6-15/h5H,2-4,6H2,1H3,(H,12,16)(H2,11,13,14) |
| InChIKey | CVHHFFILZWKHMA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |