About 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one
4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one (PubChem CID 171704646) has the molecular formula C10H9ClN4OS
and a molecular weight of 268.73 g/mol. Its IUPAC name is 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one |
| PubChem CID | 171704646 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one |
| SMILES | O=C1CN(c2nc(Cl)nc3ccsc23)CCN1 |
| InChI | InChI=1S/C10H9ClN4OS/c11-10-13-6-1-4-17-8(6)9(14-10)15-3-2-12-7(16)5-15/h1,4H,2-3,5H2,(H,12,16) |
| InChIKey | SCJHECVGKJOVNL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one?
The IUPAC name of 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one (CID 171704646) is 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one.
What is the SMILES notation for 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one?
The canonical SMILES for 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one is O=C1CN(c2nc(Cl)nc3ccsc23)CCN1.
What is the InChIKey of 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one?
The InChIKey is SCJHECVGKJOVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN4OS/c11-10-13-6-1-4-17-8(6)9(14-10)15-3-2-12-7(16)5-15/h1,4H,2-3,5H2,(H,12,16).
What are the key properties of 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one?
4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one has a molecular weight of 268.73 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)piperazin-2-one is sourced from PubChem (CID 171704646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).