C10H10ClN3S2 — CID 119090452
2-chloro-4-thiomorpholin-4-ylthieno[3,2-d]pyrimidine (PubChem CID 119090452) has the molecular formula C10H10ClN3S2 and a molecular weight of 271.80 g/mol. Its IUPAC name is 2-chloro-4-thiomorpholin-4-ylthieno[3,2-d]pyrimidine.
| Compound Name | 2-chloro-4-thiomorpholin-4-ylthieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 119090452 |
| Molecular Formula | C10H10ClN3S2 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-chloro-4-thiomorpholin-4-ylthieno[3,2-d]pyrimidine |
| SMILES | Clc1nc(N2CCSCC2)c2sccc2n1 |
| InChI | InChI=1S/C10H10ClN3S2/c11-10-12-7-1-4-16-8(7)9(13-10)14-2-5-15-6-3-14/h1,4H,2-3,5-6H2 |
| InChIKey | WTWPZUHZFJTHDV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |