C11H12ClN3OS — CID 164581492
(3R)-4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-3-methylmorpholine (PubChem CID 164581492) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is (3R)-4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-3-methylmorpholine.
| Compound Name | (3R)-4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-3-methylmorpholine |
|---|---|
| PubChem CID | 164581492 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (3R)-4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-3-methylmorpholine |
| SMILES | C[C@@H]1COCCN1c1nc(Cl)nc2ccsc12 |
| InChI | InChI=1S/C11H12ClN3OS/c1-7-6-16-4-3-15(7)10-9-8(2-5-17-9)13-11(12)14-10/h2,5,7H,3-4,6H2,1H3/t7-/m1/s1 |
| InChIKey | KUABSGGUJCJKII-SSDOTTSWSA-N |
| XLogP | 2.57 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |