C12H13Cl2N3OS — CID 164581544
(3R)-4-[2-chloro-7-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]-3-methylmorpholine (PubChem CID 164581544) has the molecular formula C12H13Cl2N3OS and a molecular weight of 318.23 g/mol. Its IUPAC name is (3R)-4-[2-chloro-7-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]-3-methylmorpholine.
| Compound Name | (3R)-4-[2-chloro-7-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 164581544 |
| Molecular Formula | C12H13Cl2N3OS |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | (3R)-4-[2-chloro-7-(chloromethyl)thieno[3,2-d]pyrimidin-4-yl]-3-methylmorpholine |
| SMILES | C[C@@H]1COCCN1c1nc(Cl)nc2c(CCl)csc12 |
| InChI | InChI=1S/C12H13Cl2N3OS/c1-7-5-18-3-2-17(7)11-10-9(15-12(14)16-11)8(4-13)6-19-10/h6-7H,2-5H2,1H3/t7-/m1/s1 |
| InChIKey | CCLGTLRRTAGSJK-SSDOTTSWSA-N |
| XLogP | 3.31 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|