About (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine
(3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine (PubChem CID 59829505) has the molecular formula C11H12ClN3OS
and a molecular weight of 269.76 g/mol. Its IUPAC name is (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine.
Molecular Properties
| Compound Name | (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine |
| PubChem CID | 59829505 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine |
| SMILES | C[C@H]1COCCN1c1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C11H12ClN3OS/c1-7-6-16-4-3-15(7)9-8-2-5-17-10(8)14-11(12)13-9/h2,5,7H,3-4,6H2,1H3/t7-/m0/s1 |
| InChIKey | UISVSUGDUITIBH-ZETCQYMHSA-N |
| XLogP | 2.57 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine?
The IUPAC name of (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine (CID 59829505) is (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine.
What is the SMILES notation for (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine?
The canonical SMILES for (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine is C[C@H]1COCCN1c1nc(Cl)nc2sccc12.
What is the InChIKey of (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine?
The InChIKey is UISVSUGDUITIBH-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H12ClN3OS/c1-7-6-16-4-3-15(7)9-8-2-5-17-10(8)14-11(12)13-9/h2,5,7H,3-4,6H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine?
(3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine has a molecular weight of 269.76 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-(2-chlorothieno[2,3-d]pyrimidin-4-yl)-3-methylmorpholine is sourced from PubChem (CID 59829505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).