C9H8ClN3S — CID 130547969
4-(azetidin-1-yl)-2-chlorothieno[2,3-d]pyrimidine (PubChem CID 130547969) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-2-chlorothieno[2,3-d]pyrimidine.
| Compound Name | 4-(azetidin-1-yl)-2-chlorothieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 130547969 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 4-(azetidin-1-yl)-2-chlorothieno[2,3-d]pyrimidine |
| SMILES | Clc1nc(N2CCC2)c2ccsc2n1 |
| InChI | InChI=1S/C9H8ClN3S/c10-9-11-7(13-3-1-4-13)6-2-5-14-8(6)12-9/h2,5H,1,3-4H2 |
| InChIKey | IBCYGJVREMSVJT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |