C11H13ClN2O2S — CID 61419163
5-chloro-6-(1,4-thiazepan-4-yl)pyridine-3-carboxylic acid (PubChem CID 61419163) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 5-chloro-6-(1,4-thiazepan-4-yl)pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-(1,4-thiazepan-4-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61419163 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-chloro-6-(1,4-thiazepan-4-yl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClN2O2S/c12-9-6-8(11(15)16)7-13-10(9)14-2-1-4-17-5-3-14/h6-7H,1-5H2,(H,15,16) |
| InChIKey | IPCVWPNWCBVBDV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |