C11H14ClN3OS — CID 55042155
(6-amino-5-chloro-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone (PubChem CID 55042155) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is (6-amino-5-chloro-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone.
| Compound Name | (6-amino-5-chloro-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 55042155 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (6-amino-5-chloro-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone |
| SMILES | Nc1ncc(C(=O)N2CCCSCC2)cc1Cl |
| InChI | InChI=1S/C11H14ClN3OS/c12-9-6-8(7-14-10(9)13)11(16)15-2-1-4-17-5-3-15/h6-7H,1-5H2,(H2,13,14) |
| InChIKey | SFAJBUTVNJGSGE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |