C9H14N4OS — CID 61423629
(5-amino-1H-pyrazol-4-yl)-(1,4-thiazepan-4-yl)methanone (PubChem CID 61423629) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is (5-amino-1H-pyrazol-4-yl)-(1,4-thiazepan-4-yl)methanone.
| Compound Name | (5-amino-1H-pyrazol-4-yl)-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 61423629 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (5-amino-1H-pyrazol-4-yl)-(1,4-thiazepan-4-yl)methanone |
| SMILES | Nc1[nH]ncc1C(=O)N1CCCSCC1 |
| InChI | InChI=1S/C9H14N4OS/c10-8-7(6-11-12-8)9(14)13-2-1-4-15-5-3-13/h6H,1-5H2,(H3,10,11,12) |
| InChIKey | CKJHQGCLPBJLLQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |