C12H15N7O — CID 43159521
(5-amino-1H-pyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 43159521) has the molecular formula C12H15N7O and a molecular weight of 273.30 g/mol. Its IUPAC name is (5-amino-1H-pyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (5-amino-1H-pyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 43159521 |
| Molecular Formula | C12H15N7O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (5-amino-1H-pyrazol-4-yl)-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | Nc1[nH]ncc1C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C12H15N7O/c13-10-9(8-16-17-10)11(20)18-4-6-19(7-5-18)12-14-2-1-3-15-12/h1-3,8H,4-7H2,(H3,13,16,17) |
| InChIKey | KVXNBRSQOUAPRP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |