C14H14N4O3S — CID 22677757
5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophene-2-carboxylic acid (PubChem CID 22677757) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 22677757 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCN(c3ncccn3)CC2)s1 |
| InChI | InChI=1S/C14H14N4O3S/c19-12(10-2-3-11(22-10)13(20)21)17-6-8-18(9-7-17)14-15-4-1-5-16-14/h1-5H,6-9H2,(H,20,21) |
| InChIKey | BSOWHBVRMJGDPJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |