C20H20N6O2S — CID 78846884
1-phenyl-3-[5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophen-2-yl]urea (PubChem CID 78846884) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-phenyl-3-[5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophen-2-yl]urea.
| Compound Name | 1-phenyl-3-[5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophen-2-yl]urea |
|---|---|
| PubChem CID | 78846884 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-phenyl-3-[5-(4-pyrimidin-2-ylpiperazine-1-carbonyl)thiophen-2-yl]urea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)N2CCN(c3ncccn3)CC2)s1 |
| InChI | InChI=1S/C20H20N6O2S/c27-18(25-11-13-26(14-12-25)19-21-9-4-10-22-19)16-7-8-17(29-16)24-20(28)23-15-5-2-1-3-6-15/h1-10H,11-14H2,(H2,23,24,28) |
| InChIKey | WYOVQUPUSIDDAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |