C23H25N5O2S — CID 78849662
N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide (PubChem CID 78849662) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78849662 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3ccc(NC(=O)Nc4ccccc4)s3)cc2)CC1 |
| InChI | InChI=1S/C23H25N5O2S/c1-27-13-15-28(16-14-27)19-9-7-18(8-10-19)24-22(29)20-11-12-21(31-20)26-23(30)25-17-5-3-2-4-6-17/h2-12H,13-16H2,1H3,(H,24,29)(H2,25,26,30) |
| InChIKey | SHDHOTKQUQFGBW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|