C18H21N3O3S — CID 134050303
methyl 5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]thiophene-2-carboxylate (PubChem CID 134050303) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is methyl 5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 134050303 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | methyl 5-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)s1 |
| InChI | InChI=1S/C18H21N3O3S/c1-20-9-11-21(12-10-20)14-5-3-13(4-6-14)19-17(22)15-7-8-16(25-15)18(23)24-2/h3-8H,9-12H2,1-2H3,(H,19,22) |
| InChIKey | FGNQUOLQTUZOPM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|