C17H16N2O4S — CID 38753329
methyl 5-[[4-(cyclopropanecarbonylamino)phenyl]carbamoyl]thiophene-2-carboxylate (PubChem CID 38753329) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 5-[[4-(cyclopropanecarbonylamino)phenyl]carbamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[4-(cyclopropanecarbonylamino)phenyl]carbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 38753329 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methyl 5-[[4-(cyclopropanecarbonylamino)phenyl]carbamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(NC(=O)C3CC3)cc2)s1 |
| InChI | InChI=1S/C17H16N2O4S/c1-23-17(22)14-9-8-13(24-14)16(21)19-12-6-4-11(5-7-12)18-15(20)10-2-3-10/h4-10H,2-3H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | SLCDJYOOPDVTTN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |