C19H25ClN4O2S — CID 119518568
1-[5-[4-(1-aminoethyl)piperidine-1-carbonyl]thiophen-2-yl]-3-phenylurea;hydrochloride (PubChem CID 119518568) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 1-[5-[4-(1-aminoethyl)piperidine-1-carbonyl]thiophen-2-yl]-3-phenylurea;hydrochloride.
| Compound Name | 1-[5-[4-(1-aminoethyl)piperidine-1-carbonyl]thiophen-2-yl]-3-phenylurea;hydrochloride |
|---|---|
| PubChem CID | 119518568 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[5-[4-(1-aminoethyl)piperidine-1-carbonyl]thiophen-2-yl]-3-phenylurea;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)c2ccc(NC(=O)Nc3ccccc3)s2)CC1.Cl |
| InChI | InChI=1S/C19H24N4O2S.ClH/c1-13(20)14-9-11-23(12-10-14)18(24)16-7-8-17(26-16)22-19(25)21-15-5-3-2-4-6-15;/h2-8,13-14H,9-12,20H2,1H3,(H2,21,22,25);1H |
| InChIKey | JQINWUIBOQEWEM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |