C11H16N4OS — CID 81256301
(4-hydrazinyl-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone (PubChem CID 81256301) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is (4-hydrazinyl-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone.
| Compound Name | (4-hydrazinyl-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 81256301 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (4-hydrazinyl-3-pyridinyl)-(1,4-thiazepan-4-yl)methanone |
| SMILES | NNc1ccncc1C(=O)N1CCCSCC1 |
| InChI | InChI=1S/C11H16N4OS/c12-14-10-2-3-13-8-9(10)11(16)15-4-1-6-17-7-5-15/h2-3,8H,1,4-7,12H2,(H,13,14) |
| InChIKey | WEEOECTVDNKAQR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|