C12H14N6O — CID 81255607
6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl-(4-hydrazinyl-3-pyridinyl)methanone (PubChem CID 81255607) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl-(4-hydrazinyl-3-pyridinyl)methanone.
| Compound Name | 6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl-(4-hydrazinyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 81255607 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl-(4-hydrazinyl-3-pyridinyl)methanone |
| SMILES | NNc1ccncc1C(=O)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H14N6O/c13-16-10-1-2-14-7-9(10)12(19)18-6-5-17-4-3-15-11(17)8-18/h1-4,7H,5-6,8,13H2,(H,14,16) |
| InChIKey | RXSYVQBWKSALDW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|