C12H15BrN2OS — CID 79722119
(2-amino-4-bromophenyl)-(1,4-thiazepan-4-yl)methanone (PubChem CID 79722119) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is (2-amino-4-bromophenyl)-(1,4-thiazepan-4-yl)methanone.
| Compound Name | (2-amino-4-bromophenyl)-(1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 79722119 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | (2-amino-4-bromophenyl)-(1,4-thiazepan-4-yl)methanone |
| SMILES | Nc1cc(Br)ccc1C(=O)N1CCCSCC1 |
| InChI | InChI=1S/C12H15BrN2OS/c13-9-2-3-10(11(14)8-9)12(16)15-4-1-6-17-7-5-15/h2-3,8H,1,4-7,14H2 |
| InChIKey | VYKGLARFIBFGMW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|