C11H15N3O — CID 61091444
(2,4-diaminophenyl)-pyrrolidin-1-ylmethanone (PubChem CID 61091444) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (2,4-diaminophenyl)-pyrrolidin-1-ylmethanone.
| Compound Name | (2,4-diaminophenyl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 61091444 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (2,4-diaminophenyl)-pyrrolidin-1-ylmethanone |
| SMILES | Nc1ccc(C(=O)N2CCCC2)c(N)c1 |
| InChI | InChI=1S/C11H15N3O/c12-8-3-4-9(10(13)7-8)11(15)14-5-1-2-6-14/h3-4,7H,1-2,5-6,12-13H2 |
| InChIKey | KDIOIOHISDRDHN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|