C15H22N4O2 — CID 61110315
1-(2,4-diaminobenzoyl)-N-ethylpiperidine-4-carboxamide (PubChem CID 61110315) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-(2,4-diaminobenzoyl)-N-ethylpiperidine-4-carboxamide.
| Compound Name | 1-(2,4-diaminobenzoyl)-N-ethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 61110315 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-(2,4-diaminobenzoyl)-N-ethylpiperidine-4-carboxamide |
| SMILES | CCNC(=O)C1CCN(C(=O)c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-2-18-14(20)10-5-7-19(8-6-10)15(21)12-4-3-11(16)9-13(12)17/h3-4,9-10H,2,5-8,16-17H2,1H3,(H,18,20) |
| InChIKey | PAHHOYPTYFQWMZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|