C15H24N4O — CID 63168429
(2,4-diaminophenyl)-[3-(diethylamino)pyrrolidin-1-yl]methanone (PubChem CID 63168429) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is (2,4-diaminophenyl)-[3-(diethylamino)pyrrolidin-1-yl]methanone.
| Compound Name | (2,4-diaminophenyl)-[3-(diethylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 63168429 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | (2,4-diaminophenyl)-[3-(diethylamino)pyrrolidin-1-yl]methanone |
| SMILES | CCN(CC)C1CCN(C(=O)c2ccc(N)cc2N)C1 |
| InChI | InChI=1S/C15H24N4O/c1-3-18(4-2)12-7-8-19(10-12)15(20)13-6-5-11(16)9-14(13)17/h5-6,9,12H,3-4,7-8,10,16-17H2,1-2H3 |
| InChIKey | OAMZCXFCPXLSHA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|