C15H22N4O — CID 79174847
(2,4-diaminophenyl)-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone (PubChem CID 79174847) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is (2,4-diaminophenyl)-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone.
| Compound Name | (2,4-diaminophenyl)-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 79174847 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (2,4-diaminophenyl)-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone |
| SMILES | CN1C2CCC1CN(C(=O)c1ccc(N)cc1N)CC2 |
| InChI | InChI=1S/C15H22N4O/c1-18-11-3-4-12(18)9-19(7-6-11)15(20)13-5-2-10(16)8-14(13)17/h2,5,8,11-12H,3-4,6-7,9,16-17H2,1H3 |
| InChIKey | JAIPSETUQFBTPM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|