C14H21N5O2 — CID 61108425
4-(2,4-diaminobenzoyl)-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 61108425) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-(2,4-diaminobenzoyl)-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-(2,4-diaminobenzoyl)-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 61108425 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 4-(2,4-diaminobenzoyl)-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(C(=O)c2ccc(N)cc2N)CC1 |
| InChI | InChI=1S/C14H21N5O2/c1-17(2)14(21)19-7-5-18(6-8-19)13(20)11-4-3-10(15)9-12(11)16/h3-4,9H,5-8,15-16H2,1-2H3 |
| InChIKey | FIEAGUDKMIZJOC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|