C8H12N4OS — CID 78968241
1,4-thiazepan-4-yl(2H-triazol-4-yl)methanone (PubChem CID 78968241) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 1,4-thiazepan-4-yl(2H-triazol-4-yl)methanone.
| Compound Name | 1,4-thiazepan-4-yl(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 78968241 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1,4-thiazepan-4-yl(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1CCCSCC1 |
| InChI | InChI=1S/C8H12N4OS/c13-8(7-6-9-11-10-7)12-2-1-4-14-5-3-12/h6H,1-5H2,(H,9,10,11) |
| InChIKey | VSYCQHKSBCRMNL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |